C17H17BrFNS — CID 66349269
N-[[3-[(5-bromo-2-fluorophenyl)methylsulfanyl]phenyl]methyl]cyclopropanamine (PubChem CID 66349269) has the molecular formula C17H17BrFNS and a molecular weight of 366.30 g/mol. Its IUPAC name is N-[[3-[(5-bromo-2-fluorophenyl)methylsulfanyl]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-[(5-bromo-2-fluorophenyl)methylsulfanyl]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 66349269 |
| Molecular Formula | C17H17BrFNS |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-[[3-[(5-bromo-2-fluorophenyl)methylsulfanyl]phenyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(Br)cc1CSc1cccc(CNC2CC2)c1 |
| InChI | InChI=1S/C17H17BrFNS/c18-14-4-7-17(19)13(9-14)11-21-16-3-1-2-12(8-16)10-20-15-5-6-15/h1-4,7-9,15,20H,5-6,10-11H2 |
| InChIKey | UMRBHAWWMZSGTE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |