C16H15BrFN — CID 106646457
N-[[3-(3-bromo-2-fluorophenyl)phenyl]methyl]cyclopropanamine (PubChem CID 106646457) has the molecular formula C16H15BrFN and a molecular weight of 320.21 g/mol. Its IUPAC name is N-[[3-(3-bromo-2-fluorophenyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(3-bromo-2-fluorophenyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106646457 |
| Molecular Formula | C16H15BrFN |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-[[3-(3-bromo-2-fluorophenyl)phenyl]methyl]cyclopropanamine |
| SMILES | Fc1c(Br)cccc1-c1cccc(CNC2CC2)c1 |
| InChI | InChI=1S/C16H15BrFN/c17-15-6-2-5-14(16(15)18)12-4-1-3-11(9-12)10-19-13-7-8-13/h1-6,9,13,19H,7-8,10H2 |
| InChIKey | JEFGPUOKOYIZGF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |