C16H14F3N — CID 61239688
N-[[3-(3,4,5-trifluorophenyl)phenyl]methyl]cyclopropanamine (PubChem CID 61239688) has the molecular formula C16H14F3N and a molecular weight of 277.29 g/mol. Its IUPAC name is N-[[3-(3,4,5-trifluorophenyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(3,4,5-trifluorophenyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 61239688 |
| Molecular Formula | C16H14F3N |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-[[3-(3,4,5-trifluorophenyl)phenyl]methyl]cyclopropanamine |
| SMILES | Fc1cc(-c2cccc(CNC3CC3)c2)cc(F)c1F |
| InChI | InChI=1S/C16H14F3N/c17-14-7-12(8-15(18)16(14)19)11-3-1-2-10(6-11)9-20-13-4-5-13/h1-3,6-8,13,20H,4-5,9H2 |
| InChIKey | FPVOTEJZGDGLEP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|