About [3-(3,4,5-trifluorophenyl)phenyl]methanol
[3-(3,4,5-trifluorophenyl)phenyl]methanol (PubChem CID 172650671) has the molecular formula C13H9F3O
and a molecular weight of 238.21 g/mol. Its IUPAC name is [3-(3,4,5-trifluorophenyl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-(3,4,5-trifluorophenyl)phenyl]methanol |
| PubChem CID | 172650671 |
| Molecular Formula | C13H9F3O |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | [3-(3,4,5-trifluorophenyl)phenyl]methanol |
| SMILES | OCc1cccc(-c2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C13H9F3O/c14-11-5-10(6-12(15)13(11)16)9-3-1-2-8(4-9)7-17/h1-6,17H,7H2 |
| InChIKey | AFUPBOXEXBDNMY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [3-(3,4,5-trifluorophenyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,4,5-trifluorophenyl)phenyl]methanol?
The IUPAC name of [3-(3,4,5-trifluorophenyl)phenyl]methanol (CID 172650671) is [3-(3,4,5-trifluorophenyl)phenyl]methanol.
What is the SMILES notation for [3-(3,4,5-trifluorophenyl)phenyl]methanol?
The canonical SMILES for [3-(3,4,5-trifluorophenyl)phenyl]methanol is OCc1cccc(-c2cc(F)c(F)c(F)c2)c1.
What is the InChIKey of [3-(3,4,5-trifluorophenyl)phenyl]methanol?
The InChIKey is AFUPBOXEXBDNMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F3O/c14-11-5-10(6-12(15)13(11)16)9-3-1-2-8(4-9)7-17/h1-6,17H,7H2.
What are the key properties of [3-(3,4,5-trifluorophenyl)phenyl]methanol?
[3-(3,4,5-trifluorophenyl)phenyl]methanol has a molecular weight of 238.21 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,4,5-trifluorophenyl)phenyl]methanol is sourced from PubChem (CID 172650671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).