C19H21N — CID 61034448
N-[[3-(2,3-dihydro-1H-inden-5-yl)phenyl]methyl]cyclopropanamine (PubChem CID 61034448) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is N-[[3-(2,3-dihydro-1H-inden-5-yl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(2,3-dihydro-1H-inden-5-yl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 61034448 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-[[3-(2,3-dihydro-1H-inden-5-yl)phenyl]methyl]cyclopropanamine |
| SMILES | c1cc(CNC2CC2)cc(-c2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C19H21N/c1-3-14(13-20-19-9-10-19)11-16(5-1)18-8-7-15-4-2-6-17(15)12-18/h1,3,5,7-8,11-12,19-20H,2,4,6,9-10,13H2 |
| InChIKey | CPHXJGBQUORLEX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |