C16H14BrF2NO — CID 107100596
N-[[3-(5-bromo-2,3-difluorophenoxy)phenyl]methyl]cyclopropanamine (PubChem CID 107100596) has the molecular formula C16H14BrF2NO and a molecular weight of 354.19 g/mol. Its IUPAC name is N-[[3-(5-bromo-2,3-difluorophenoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(5-bromo-2,3-difluorophenoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107100596 |
| Molecular Formula | C16H14BrF2NO |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-[[3-(5-bromo-2,3-difluorophenoxy)phenyl]methyl]cyclopropanamine |
| SMILES | Fc1cc(Br)cc(Oc2cccc(CNC3CC3)c2)c1F |
| InChI | InChI=1S/C16H14BrF2NO/c17-11-7-14(18)16(19)15(8-11)21-13-3-1-2-10(6-13)9-20-12-4-5-12/h1-3,6-8,12,20H,4-5,9H2 |
| InChIKey | PKCQSUAVRJRTRM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|