C15H14BrF2NO2 — CID 107101510
N-[[5-[(5-bromo-2,3-difluorophenoxy)methyl]furan-3-yl]methyl]cyclopropanamine (PubChem CID 107101510) has the molecular formula C15H14BrF2NO2 and a molecular weight of 358.18 g/mol. Its IUPAC name is N-[[5-[(5-bromo-2,3-difluorophenoxy)methyl]furan-3-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-[(5-bromo-2,3-difluorophenoxy)methyl]furan-3-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107101510 |
| Molecular Formula | C15H14BrF2NO2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | N-[[5-[(5-bromo-2,3-difluorophenoxy)methyl]furan-3-yl]methyl]cyclopropanamine |
| SMILES | Fc1cc(Br)cc(OCc2cc(CNC3CC3)co2)c1F |
| InChI | InChI=1S/C15H14BrF2NO2/c16-10-4-13(17)15(18)14(5-10)21-8-12-3-9(7-20-12)6-19-11-1-2-11/h3-5,7,11,19H,1-2,6,8H2 |
| InChIKey | YVOBGUXZNSBSCE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|