C16H18BrNO2 — CID 82831319
N-[[5-[(4-bromophenyl)methoxymethyl]furan-3-yl]methyl]cyclopropanamine (PubChem CID 82831319) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is N-[[5-[(4-bromophenyl)methoxymethyl]furan-3-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-[(4-bromophenyl)methoxymethyl]furan-3-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 82831319 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[[5-[(4-bromophenyl)methoxymethyl]furan-3-yl]methyl]cyclopropanamine |
| SMILES | Brc1ccc(COCc2cc(CNC3CC3)co2)cc1 |
| InChI | InChI=1S/C16H18BrNO2/c17-14-3-1-12(2-4-14)9-19-11-16-7-13(10-20-16)8-18-15-5-6-15/h1-4,7,10,15,18H,5-6,8-9,11H2 |
| InChIKey | ZDJHESZJJJOXFO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |