C15H15BrFNO2 — CID 62484964
N-[[5-[(4-bromo-2-fluorophenoxy)methyl]furan-3-yl]methyl]cyclopropanamine (PubChem CID 62484964) has the molecular formula C15H15BrFNO2 and a molecular weight of 340.19 g/mol. Its IUPAC name is N-[[5-[(4-bromo-2-fluorophenoxy)methyl]furan-3-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-[(4-bromo-2-fluorophenoxy)methyl]furan-3-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62484964 |
| Molecular Formula | C15H15BrFNO2 |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | N-[[5-[(4-bromo-2-fluorophenoxy)methyl]furan-3-yl]methyl]cyclopropanamine |
| SMILES | Fc1cc(Br)ccc1OCc1cc(CNC2CC2)co1 |
| InChI | InChI=1S/C15H15BrFNO2/c16-11-1-4-15(14(17)6-11)20-9-13-5-10(8-19-13)7-18-12-2-3-12/h1,4-6,8,12,18H,2-3,7,9H2 |
| InChIKey | NZDQEXOKNADTRI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |