C16H17BrFNOS — CID 80723282
N-[[4-[(4-bromo-2-fluorophenoxy)methyl]-5-methylthiophen-2-yl]methyl]cyclopropanamine (PubChem CID 80723282) has the molecular formula C16H17BrFNOS and a molecular weight of 370.29 g/mol. Its IUPAC name is N-[[4-[(4-bromo-2-fluorophenoxy)methyl]-5-methylthiophen-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[4-[(4-bromo-2-fluorophenoxy)methyl]-5-methylthiophen-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 80723282 |
| Molecular Formula | C16H17BrFNOS |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N-[[4-[(4-bromo-2-fluorophenoxy)methyl]-5-methylthiophen-2-yl]methyl]cyclopropanamine |
| SMILES | Cc1sc(CNC2CC2)cc1COc1ccc(Br)cc1F |
| InChI | InChI=1S/C16H17BrFNOS/c1-10-11(6-14(21-10)8-19-13-3-4-13)9-20-16-5-2-12(17)7-15(16)18/h2,5-7,13,19H,3-4,8-9H2,1H3 |
| InChIKey | FOLNQORZJZGWIH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |