C12H9BrF2N2O3 — CID 107101927
5-[(5-bromo-2,3-difluorophenoxy)methyl]furan-3-carbohydrazide (PubChem CID 107101927) has the molecular formula C12H9BrF2N2O3 and a molecular weight of 347.12 g/mol. Its IUPAC name is 5-[(5-bromo-2,3-difluorophenoxy)methyl]furan-3-carbohydrazide.
| Compound Name | 5-[(5-bromo-2,3-difluorophenoxy)methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 107101927 |
| Molecular Formula | C12H9BrF2N2O3 |
| Molecular Weight | 347.12 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 5-[(5-bromo-2,3-difluorophenoxy)methyl]furan-3-carbohydrazide |
| SMILES | NNC(=O)c1coc(COc2cc(Br)cc(F)c2F)c1 |
| InChI | InChI=1S/C12H9BrF2N2O3/c13-7-2-9(14)11(15)10(3-7)20-5-8-1-6(4-19-8)12(18)17-16/h1-4H,5,16H2,(H,17,18) |
| InChIKey | WPCAEQZFIREVQN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|