C12H10Cl2N2O3 — CID 63575027
5-[(2,3-dichlorophenoxy)methyl]furan-3-carbohydrazide (PubChem CID 63575027) has the molecular formula C12H10Cl2N2O3 and a molecular weight of 301.13 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenoxy)methyl]furan-3-carbohydrazide.
| Compound Name | 5-[(2,3-dichlorophenoxy)methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 63575027 |
| Molecular Formula | C12H10Cl2N2O3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 5-[(2,3-dichlorophenoxy)methyl]furan-3-carbohydrazide |
| SMILES | NNC(=O)c1coc(COc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2O3/c13-9-2-1-3-10(11(9)14)19-6-8-4-7(5-18-8)12(17)16-15/h1-5H,6,15H2,(H,16,17) |
| InChIKey | AKZKNIKPLLXAOG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|