C11H8BrF2N3O2S — CID 107101923
4-[(5-bromo-2,3-difluorophenoxy)methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 107101923) has the molecular formula C11H8BrF2N3O2S and a molecular weight of 364.17 g/mol. Its IUPAC name is 4-[(5-bromo-2,3-difluorophenoxy)methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(5-bromo-2,3-difluorophenoxy)methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 107101923 |
| Molecular Formula | C11H8BrF2N3O2S |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | 4-[(5-bromo-2,3-difluorophenoxy)methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(COc2cc(Br)cc(F)c2F)cs1 |
| InChI | InChI=1S/C11H8BrF2N3O2S/c12-5-1-7(13)9(14)8(2-5)19-3-6-4-20-11(16-6)10(18)17-15/h1-2,4H,3,15H2,(H,17,18) |
| InChIKey | ZEWZUAGCDZBCCX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|