C13H12BrF2NOS — CID 107098522
4-[(5-bromo-2,3-difluorophenoxy)methyl]-2-propyl-1,3-thiazole (PubChem CID 107098522) has the molecular formula C13H12BrF2NOS and a molecular weight of 348.21 g/mol. Its IUPAC name is 4-[(5-bromo-2,3-difluorophenoxy)methyl]-2-propyl-1,3-thiazole.
| Compound Name | 4-[(5-bromo-2,3-difluorophenoxy)methyl]-2-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 107098522 |
| Molecular Formula | C13H12BrF2NOS |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 4-[(5-bromo-2,3-difluorophenoxy)methyl]-2-propyl-1,3-thiazole |
| SMILES | CCCc1nc(COc2cc(Br)cc(F)c2F)cs1 |
| InChI | InChI=1S/C13H12BrF2NOS/c1-2-3-12-17-9(7-19-12)6-18-11-5-8(14)4-10(15)13(11)16/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | VBCKLSAETJTQLF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|