C11H8BrF2NOS — CID 107098783
4-[(5-bromo-2,3-difluorophenoxy)methyl]-2-methyl-1,3-thiazole (PubChem CID 107098783) has the molecular formula C11H8BrF2NOS and a molecular weight of 320.16 g/mol. Its IUPAC name is 4-[(5-bromo-2,3-difluorophenoxy)methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[(5-bromo-2,3-difluorophenoxy)methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 107098783 |
| Molecular Formula | C11H8BrF2NOS |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 4-[(5-bromo-2,3-difluorophenoxy)methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(COc2cc(Br)cc(F)c2F)cs1 |
| InChI | InChI=1S/C11H8BrF2NOS/c1-6-15-8(5-17-6)4-16-10-3-7(12)2-9(13)11(10)14/h2-3,5H,4H2,1H3 |
| InChIKey | NITSNYPYKFHVMN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|