C14H21NO2S2 — CID 66349069
N-[[3-(2-ethylsulfonylethylsulfanyl)phenyl]methyl]cyclopropanamine (PubChem CID 66349069) has the molecular formula C14H21NO2S2 and a molecular weight of 299.46 g/mol. Its IUPAC name is N-[[3-(2-ethylsulfonylethylsulfanyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(2-ethylsulfonylethylsulfanyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 66349069 |
| Molecular Formula | C14H21NO2S2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-[[3-(2-ethylsulfonylethylsulfanyl)phenyl]methyl]cyclopropanamine |
| SMILES | CCS(=O)(=O)CCSc1cccc(CNC2CC2)c1 |
| InChI | InChI=1S/C14H21NO2S2/c1-2-19(16,17)9-8-18-14-5-3-4-12(10-14)11-15-13-6-7-13/h3-5,10,13,15H,2,6-9,11H2,1H3 |
| InChIKey | CGVMTODYOQQVGN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |