C15H25NO3S2 — CID 66348142
N-[[3-(3-ethylsulfonylpropylsulfanyl)phenyl]methyl]-2-methoxyethanamine (PubChem CID 66348142) has the molecular formula C15H25NO3S2 and a molecular weight of 331.50 g/mol. Its IUPAC name is N-[[3-(3-ethylsulfonylpropylsulfanyl)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-(3-ethylsulfonylpropylsulfanyl)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 66348142 |
| Molecular Formula | C15H25NO3S2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[[3-(3-ethylsulfonylpropylsulfanyl)phenyl]methyl]-2-methoxyethanamine |
| SMILES | CCS(=O)(=O)CCCSc1cccc(CNCCOC)c1 |
| InChI | InChI=1S/C15H25NO3S2/c1-3-21(17,18)11-5-10-20-15-7-4-6-14(12-15)13-16-8-9-19-2/h4,6-7,12,16H,3,5,8-11,13H2,1-2H3 |
| InChIKey | QCVAMWUDFLUBDO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|