C14H23NO2S — CID 66348144
2-methoxy-N-[[3-(3-methoxypropylsulfanyl)phenyl]methyl]ethanamine (PubChem CID 66348144) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-methoxy-N-[[3-(3-methoxypropylsulfanyl)phenyl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[3-(3-methoxypropylsulfanyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 66348144 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-methoxy-N-[[3-(3-methoxypropylsulfanyl)phenyl]methyl]ethanamine |
| SMILES | COCCCSc1cccc(CNCCOC)c1 |
| InChI | InChI=1S/C14H23NO2S/c1-16-8-4-10-18-14-6-3-5-13(11-14)12-15-7-9-17-2/h3,5-6,11,15H,4,7-10,12H2,1-2H3 |
| InChIKey | UYOIMKPHAOALPF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|