C13H18F3NOS2 — CID 116627082
2-methoxy-N-[[3-[2-(trifluoromethylsulfanyl)ethylsulfanyl]phenyl]methyl]ethanamine (PubChem CID 116627082) has the molecular formula C13H18F3NOS2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-methoxy-N-[[3-[2-(trifluoromethylsulfanyl)ethylsulfanyl]phenyl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[3-[2-(trifluoromethylsulfanyl)ethylsulfanyl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 116627082 |
| Molecular Formula | C13H18F3NOS2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-methoxy-N-[[3-[2-(trifluoromethylsulfanyl)ethylsulfanyl]phenyl]methyl]ethanamine |
| SMILES | COCCNCc1cccc(SCCSC(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NOS2/c1-18-6-5-17-10-11-3-2-4-12(9-11)19-7-8-20-13(14,15)16/h2-4,9,17H,5-8,10H2,1H3 |
| InChIKey | OJWXFRZLDHXADQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|