C12H14N2S — CID 66348489
2-[3-[(cyclopropylamino)methyl]phenyl]sulfanylacetonitrile (PubChem CID 66348489) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-[3-[(cyclopropylamino)methyl]phenyl]sulfanylacetonitrile.
| Compound Name | 2-[3-[(cyclopropylamino)methyl]phenyl]sulfanylacetonitrile |
|---|---|
| PubChem CID | 66348489 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-[3-[(cyclopropylamino)methyl]phenyl]sulfanylacetonitrile |
| SMILES | N#CCSc1cccc(CNC2CC2)c1 |
| InChI | InChI=1S/C12H14N2S/c13-6-7-15-12-3-1-2-10(8-12)9-14-11-4-5-11/h1-3,8,11,14H,4-5,7,9H2 |
| InChIKey | KEBGOOZUYUALLM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |