C11H14N2S — CID 66347852
2-[3-(ethylaminomethyl)phenyl]sulfanylacetonitrile (PubChem CID 66347852) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-[3-(ethylaminomethyl)phenyl]sulfanylacetonitrile.
| Compound Name | 2-[3-(ethylaminomethyl)phenyl]sulfanylacetonitrile |
|---|---|
| PubChem CID | 66347852 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-[3-(ethylaminomethyl)phenyl]sulfanylacetonitrile |
| SMILES | CCNCc1cccc(SCC#N)c1 |
| InChI | InChI=1S/C11H14N2S/c1-2-13-9-10-4-3-5-11(8-10)14-7-6-12/h3-5,8,13H,2,7,9H2,1H3 |
| InChIKey | ZMWWSNUIFDQXAP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |