C17H17N3S — CID 66349651
4-[[3-[(cyclopropylamino)methyl]phenyl]sulfanylmethyl]pyridine-2-carbonitrile (PubChem CID 66349651) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is 4-[[3-[(cyclopropylamino)methyl]phenyl]sulfanylmethyl]pyridine-2-carbonitrile.
| Compound Name | 4-[[3-[(cyclopropylamino)methyl]phenyl]sulfanylmethyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 66349651 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-[[3-[(cyclopropylamino)methyl]phenyl]sulfanylmethyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(CSc2cccc(CNC3CC3)c2)ccn1 |
| InChI | InChI=1S/C17H17N3S/c18-10-16-8-14(6-7-19-16)12-21-17-3-1-2-13(9-17)11-20-15-4-5-15/h1-3,6-9,15,20H,4-5,11-12H2 |
| InChIKey | ZTFBFINTLRGJBY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |