C12H10N4S — CID 63881760
4-[(6-amino-3-pyridinyl)sulfanylmethyl]pyridine-2-carbonitrile (PubChem CID 63881760) has the molecular formula C12H10N4S and a molecular weight of 242.31 g/mol. Its IUPAC name is 4-[(6-amino-3-pyridinyl)sulfanylmethyl]pyridine-2-carbonitrile.
| Compound Name | 4-[(6-amino-3-pyridinyl)sulfanylmethyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 63881760 |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-[(6-amino-3-pyridinyl)sulfanylmethyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(CSc2ccc(N)nc2)ccn1 |
| InChI | InChI=1S/C12H10N4S/c13-6-10-5-9(3-4-15-10)8-17-11-1-2-12(14)16-7-11/h1-5,7H,8H2,(H2,14,16) |
| InChIKey | CNZOTSSDAIDDSG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |