C13H10FN3S — CID 64770255
2-[(6-amino-3-pyridinyl)sulfanylmethyl]-4-fluorobenzonitrile (PubChem CID 64770255) has the molecular formula C13H10FN3S and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[(6-amino-3-pyridinyl)sulfanylmethyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(6-amino-3-pyridinyl)sulfanylmethyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 64770255 |
| Molecular Formula | C13H10FN3S |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-[(6-amino-3-pyridinyl)sulfanylmethyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1CSc1ccc(N)nc1 |
| InChI | InChI=1S/C13H10FN3S/c14-11-2-1-9(6-15)10(5-11)8-18-12-3-4-13(16)17-7-12/h1-5,7H,8H2,(H2,16,17) |
| InChIKey | LNAOEVBPHXCTAZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |