C18H21NOS — CID 66347327
2-[3-[(cyclopropylamino)methyl]phenyl]sulfanyl-1-phenylethanol (PubChem CID 66347327) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-[3-[(cyclopropylamino)methyl]phenyl]sulfanyl-1-phenylethanol.
| Compound Name | 2-[3-[(cyclopropylamino)methyl]phenyl]sulfanyl-1-phenylethanol |
|---|---|
| PubChem CID | 66347327 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[3-[(cyclopropylamino)methyl]phenyl]sulfanyl-1-phenylethanol |
| SMILES | OC(CSc1cccc(CNC2CC2)c1)c1ccccc1 |
| InChI | InChI=1S/C18H21NOS/c20-18(15-6-2-1-3-7-15)13-21-17-8-4-5-14(11-17)12-19-16-9-10-16/h1-8,11,16,18-20H,9-10,12-13H2 |
| InChIKey | BURBLBVGXNELCM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |