C19H23NO — CID 62443430
N-[[3-(1-phenylethoxymethyl)phenyl]methyl]cyclopropanamine (PubChem CID 62443430) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[[3-(1-phenylethoxymethyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(1-phenylethoxymethyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62443430 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-[[3-(1-phenylethoxymethyl)phenyl]methyl]cyclopropanamine |
| SMILES | CC(OCc1cccc(CNC2CC2)c1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO/c1-15(18-8-3-2-4-9-18)21-14-17-7-5-6-16(12-17)13-20-19-10-11-19/h2-9,12,15,19-20H,10-11,13-14H2,1H3 |
| InChIKey | SRKNMOFABSPCFR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |