C17H18ClNS — CID 81159406
N-[[3-chloro-4-(3-methylphenyl)sulfanylphenyl]methyl]cyclopropanamine (PubChem CID 81159406) has the molecular formula C17H18ClNS and a molecular weight of 303.86 g/mol. Its IUPAC name is N-[[3-chloro-4-(3-methylphenyl)sulfanylphenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-chloro-4-(3-methylphenyl)sulfanylphenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 81159406 |
| Molecular Formula | C17H18ClNS |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | N-[[3-chloro-4-(3-methylphenyl)sulfanylphenyl]methyl]cyclopropanamine |
| SMILES | Cc1cccc(Sc2ccc(CNC3CC3)cc2Cl)c1 |
| InChI | InChI=1S/C17H18ClNS/c1-12-3-2-4-15(9-12)20-17-8-5-13(10-16(17)18)11-19-14-6-7-14/h2-5,8-10,14,19H,6-7,11H2,1H3 |
| InChIKey | AVAPHHWMVBNDPR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |