C11H13BrOS — CID 66159404
1-(3-bromophenyl)sulfanylpent-4-en-2-ol (PubChem CID 66159404) has the molecular formula C11H13BrOS and a molecular weight of 273.20 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfanylpent-4-en-2-ol.
| Compound Name | 1-(3-bromophenyl)sulfanylpent-4-en-2-ol |
|---|---|
| PubChem CID | 66159404 |
| Molecular Formula | C11H13BrOS |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 1-(3-bromophenyl)sulfanylpent-4-en-2-ol |
| SMILES | C=CCC(O)CSc1cccc(Br)c1 |
| InChI | InChI=1S/C11H13BrOS/c1-2-4-10(13)8-14-11-6-3-5-9(12)7-11/h2-3,5-7,10,13H,1,4,8H2 |
| InChIKey | QGRIJFJJGCTQQL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|