C16H23BrO — CID 64738018
2-(3-bromophenyl)-1-(3,4-dimethylcyclohexyl)ethanol (PubChem CID 64738018) has the molecular formula C16H23BrO and a molecular weight of 311.26 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-(3,4-dimethylcyclohexyl)ethanol.
| Compound Name | 2-(3-bromophenyl)-1-(3,4-dimethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 64738018 |
| Molecular Formula | C16H23BrO |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-(3-bromophenyl)-1-(3,4-dimethylcyclohexyl)ethanol |
| SMILES | CC1CCC(C(O)Cc2cccc(Br)c2)CC1C |
| InChI | InChI=1S/C16H23BrO/c1-11-6-7-14(8-12(11)2)16(18)10-13-4-3-5-15(17)9-13/h3-5,9,11-12,14,16,18H,6-8,10H2,1-2H3 |
| InChIKey | FHVSOYCRSXSZFI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |