C15H21BrO2 — CID 65401348
2-(3-bromo-4-methoxyphenyl)-1-(3-methylcyclopentyl)ethanol (PubChem CID 65401348) has the molecular formula C15H21BrO2 and a molecular weight of 313.24 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1-(3-methylcyclopentyl)ethanol.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1-(3-methylcyclopentyl)ethanol |
|---|---|
| PubChem CID | 65401348 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1-(3-methylcyclopentyl)ethanol |
| SMILES | COc1ccc(CC(O)C2CCC(C)C2)cc1Br |
| InChI | InChI=1S/C15H21BrO2/c1-10-3-5-12(7-10)14(17)9-11-4-6-15(18-2)13(16)8-11/h4,6,8,10,12,14,17H,3,5,7,9H2,1-2H3 |
| InChIKey | ZYOOVGUYPYISSH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |