C17H25BrO2 — CID 65400931
2-(3-bromo-4-methoxyphenyl)-1-(3-ethylcyclohexyl)ethanol (PubChem CID 65400931) has the molecular formula C17H25BrO2 and a molecular weight of 341.29 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1-(3-ethylcyclohexyl)ethanol.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1-(3-ethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 65400931 |
| Molecular Formula | C17H25BrO2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1-(3-ethylcyclohexyl)ethanol |
| SMILES | CCC1CCCC(C(O)Cc2ccc(OC)c(Br)c2)C1 |
| InChI | InChI=1S/C17H25BrO2/c1-3-12-5-4-6-14(9-12)16(19)11-13-7-8-17(20-2)15(18)10-13/h7-8,10,12,14,16,19H,3-6,9,11H2,1-2H3 |
| InChIKey | KENGWSPOBUBDSW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |