C18H26O — CID 65409563
2-(2,3-dihydro-1H-inden-5-yl)-1-(3-ethylcyclopentyl)ethanol (PubChem CID 65409563) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)-1-(3-ethylcyclopentyl)ethanol.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)-1-(3-ethylcyclopentyl)ethanol |
|---|---|
| PubChem CID | 65409563 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)-1-(3-ethylcyclopentyl)ethanol |
| SMILES | CCC1CCC(C(O)Cc2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C18H26O/c1-2-13-6-9-17(10-13)18(19)12-14-7-8-15-4-3-5-16(15)11-14/h7-8,11,13,17-19H,2-6,9-10,12H2,1H3 |
| InChIKey | XEUHFQOJQIIJJD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |