C16H21F3O — CID 65410943
1-(3-ethylcyclopentyl)-2-[4-(trifluoromethyl)phenyl]ethanol (PubChem CID 65410943) has the molecular formula C16H21F3O and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-(3-ethylcyclopentyl)-2-[4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 1-(3-ethylcyclopentyl)-2-[4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 65410943 |
| Molecular Formula | C16H21F3O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-(3-ethylcyclopentyl)-2-[4-(trifluoromethyl)phenyl]ethanol |
| SMILES | CCC1CCC(C(O)Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C16H21F3O/c1-2-11-3-6-13(9-11)15(20)10-12-4-7-14(8-5-12)16(17,18)19/h4-5,7-8,11,13,15,20H,2-3,6,9-10H2,1H3 |
| InChIKey | CIHWPZDYUSBWBU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |