C20H30O — CID 65425263
2-(2,3-dihydro-1H-inden-5-yl)-1-(4-propylcyclohexyl)ethanol (PubChem CID 65425263) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)-1-(4-propylcyclohexyl)ethanol.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)-1-(4-propylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 65425263 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)-1-(4-propylcyclohexyl)ethanol |
| SMILES | CCCC1CCC(C(O)Cc2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C20H30O/c1-2-4-15-7-11-18(12-8-15)20(21)14-16-9-10-17-5-3-6-19(17)13-16/h9-10,13,15,18,20-21H,2-8,11-12,14H2,1H3 |
| InChIKey | LODUCWKIHCKEHF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |