C17H25N — CID 115865018
1-cyclopentyl-3-(2,3-dihydro-1H-inden-5-yl)propan-2-amine (PubChem CID 115865018) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,3-dihydro-1H-inden-5-yl)propan-2-amine.
| Compound Name | 1-cyclopentyl-3-(2,3-dihydro-1H-inden-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 115865018 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 1-cyclopentyl-3-(2,3-dihydro-1H-inden-5-yl)propan-2-amine |
| SMILES | NC(Cc1ccc2c(c1)CCC2)CC1CCCC1 |
| InChI | InChI=1S/C17H25N/c18-17(11-13-4-1-2-5-13)12-14-8-9-15-6-3-7-16(15)10-14/h8-10,13,17H,1-7,11-12,18H2 |
| InChIKey | NRYAGXBIJBYOEM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |