C15H23BrOS — CID 65423327
2-(5-bromothiophen-2-yl)-1-(4-propylcyclohexyl)ethanol (PubChem CID 65423327) has the molecular formula C15H23BrOS and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-1-(4-propylcyclohexyl)ethanol.
| Compound Name | 2-(5-bromothiophen-2-yl)-1-(4-propylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 65423327 |
| Molecular Formula | C15H23BrOS |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-1-(4-propylcyclohexyl)ethanol |
| SMILES | CCCC1CCC(C(O)Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C15H23BrOS/c1-2-3-11-4-6-12(7-5-11)14(17)10-13-8-9-15(16)18-13/h8-9,11-12,14,17H,2-7,10H2,1H3 |
| InChIKey | DSJMNDQBAWLWHN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |