C9H13BrN2S — CID 105202339
[2-(5-bromothiophen-2-yl)-1-cyclopropylethyl]hydrazine (PubChem CID 105202339) has the molecular formula C9H13BrN2S and a molecular weight of 261.19 g/mol. Its IUPAC name is [2-(5-bromothiophen-2-yl)-1-cyclopropylethyl]hydrazine.
| Compound Name | [2-(5-bromothiophen-2-yl)-1-cyclopropylethyl]hydrazine |
|---|---|
| PubChem CID | 105202339 |
| Molecular Formula | C9H13BrN2S |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | [2-(5-bromothiophen-2-yl)-1-cyclopropylethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Br)s1)C1CC1 |
| InChI | InChI=1S/C9H13BrN2S/c10-9-4-3-7(13-9)5-8(12-11)6-1-2-6/h3-4,6,8,12H,1-2,5,11H2 |
| InChIKey | DFAYXTKSKUDQSE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|