C10H17BrN2S — CID 105202918
[1-(5-bromothiophen-2-yl)-3,3-dimethylbutan-2-yl]hydrazine (PubChem CID 105202918) has the molecular formula C10H17BrN2S and a molecular weight of 277.23 g/mol. Its IUPAC name is [1-(5-bromothiophen-2-yl)-3,3-dimethylbutan-2-yl]hydrazine.
| Compound Name | [1-(5-bromothiophen-2-yl)-3,3-dimethylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105202918 |
| Molecular Formula | C10H17BrN2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | [1-(5-bromothiophen-2-yl)-3,3-dimethylbutan-2-yl]hydrazine |
| SMILES | CC(C)(C)C(Cc1ccc(Br)s1)NN |
| InChI | InChI=1S/C10H17BrN2S/c1-10(2,3)8(13-12)6-7-4-5-9(11)14-7/h4-5,8,13H,6,12H2,1-3H3 |
| InChIKey | BJVGNAMDSHIOCW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|