C11H17BrOS — CID 63890851
1-(5-bromothiophen-2-yl)-4,4-dimethylpentan-2-ol (PubChem CID 63890851) has the molecular formula C11H17BrOS and a molecular weight of 277.23 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-4,4-dimethylpentan-2-ol.
| Compound Name | 1-(5-bromothiophen-2-yl)-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 63890851 |
| Molecular Formula | C11H17BrOS |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C11H17BrOS/c1-11(2,3)7-8(13)6-9-4-5-10(12)14-9/h4-5,8,13H,6-7H2,1-3H3 |
| InChIKey | SMBZYJZLDLSDFN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |