C12H19BrO2S — CID 103459887
1-(5-bromothiophen-2-yl)-4-ethylhexane-2,3-diol (PubChem CID 103459887) has the molecular formula C12H19BrO2S and a molecular weight of 307.25 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-4-ethylhexane-2,3-diol.
| Compound Name | 1-(5-bromothiophen-2-yl)-4-ethylhexane-2,3-diol |
|---|---|
| PubChem CID | 103459887 |
| Molecular Formula | C12H19BrO2S |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-4-ethylhexane-2,3-diol |
| SMILES | CCC(CC)C(O)C(O)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C12H19BrO2S/c1-3-8(4-2)12(15)10(14)7-9-5-6-11(13)16-9/h5-6,8,10,12,14-15H,3-4,7H2,1-2H3 |
| InChIKey | SWDOQLBGENAEGL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |