C15H26BrNOS — CID 79061202
1-(5-bromothiophen-2-yl)-3-(diethylamino)-3-ethylpentan-2-ol (PubChem CID 79061202) has the molecular formula C15H26BrNOS and a molecular weight of 348.35 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-3-(diethylamino)-3-ethylpentan-2-ol.
| Compound Name | 1-(5-bromothiophen-2-yl)-3-(diethylamino)-3-ethylpentan-2-ol |
|---|---|
| PubChem CID | 79061202 |
| Molecular Formula | C15H26BrNOS |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-3-(diethylamino)-3-ethylpentan-2-ol |
| SMILES | CCN(CC)C(CC)(CC)C(O)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C15H26BrNOS/c1-5-15(6-2,17(7-3)8-4)13(18)11-12-9-10-14(16)19-12/h9-10,13,18H,5-8,11H2,1-4H3 |
| InChIKey | XDAPMHXWEPOURV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |