C14H24ClNOS — CID 79063462
1-(5-chlorothiophen-2-yl)-3-(diethylamino)-3-methylpentan-2-ol (PubChem CID 79063462) has the molecular formula C14H24ClNOS and a molecular weight of 289.87 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-(diethylamino)-3-methylpentan-2-ol.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-(diethylamino)-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 79063462 |
| Molecular Formula | C14H24ClNOS |
| Molecular Weight | 289.87 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-(diethylamino)-3-methylpentan-2-ol |
| SMILES | CCN(CC)C(C)(CC)C(O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H24ClNOS/c1-5-14(4,16(6-2)7-3)12(17)10-11-8-9-13(15)18-11/h8-9,12,17H,5-7,10H2,1-4H3 |
| InChIKey | MICSFJNWDUJFQM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |