C16H25BrFNO — CID 79063697
1-(4-bromo-2-fluorophenyl)-3-(diethylamino)-3-methylpentan-2-ol (PubChem CID 79063697) has the molecular formula C16H25BrFNO and a molecular weight of 346.28 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-(diethylamino)-3-methylpentan-2-ol.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-(diethylamino)-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 79063697 |
| Molecular Formula | C16H25BrFNO |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-(diethylamino)-3-methylpentan-2-ol |
| SMILES | CCN(CC)C(C)(CC)C(O)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C16H25BrFNO/c1-5-16(4,19(6-2)7-3)15(20)10-12-8-9-13(17)11-14(12)18/h8-9,11,15,20H,5-7,10H2,1-4H3 |
| InChIKey | DPHFOKHKOSPBSS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |