C13H18BrFO3 — CID 79495756
3-(4-bromo-2-fluorophenyl)-1,1-diethoxypropan-2-ol (PubChem CID 79495756) has the molecular formula C13H18BrFO3 and a molecular weight of 321.19 g/mol. Its IUPAC name is 3-(4-bromo-2-fluorophenyl)-1,1-diethoxypropan-2-ol.
| Compound Name | 3-(4-bromo-2-fluorophenyl)-1,1-diethoxypropan-2-ol |
|---|---|
| PubChem CID | 79495756 |
| Molecular Formula | C13H18BrFO3 |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 3-(4-bromo-2-fluorophenyl)-1,1-diethoxypropan-2-ol |
| SMILES | CCOC(OCC)C(O)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C13H18BrFO3/c1-3-17-13(18-4-2)12(16)7-9-5-6-10(14)8-11(9)15/h5-6,8,12-13,16H,3-4,7H2,1-2H3 |
| InChIKey | GWMPITDFMSZJDA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|