C15H23BrFNO2 — CID 79495115
3-(4-bromo-2-fluorophenyl)-1,1-diethoxy-N-ethylpropan-2-amine (PubChem CID 79495115) has the molecular formula C15H23BrFNO2 and a molecular weight of 348.26 g/mol. Its IUPAC name is 3-(4-bromo-2-fluorophenyl)-1,1-diethoxy-N-ethylpropan-2-amine.
| Compound Name | 3-(4-bromo-2-fluorophenyl)-1,1-diethoxy-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 79495115 |
| Molecular Formula | C15H23BrFNO2 |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-(4-bromo-2-fluorophenyl)-1,1-diethoxy-N-ethylpropan-2-amine |
| SMILES | CCNC(Cc1ccc(Br)cc1F)C(OCC)OCC |
| InChI | InChI=1S/C15H23BrFNO2/c1-4-18-14(15(19-5-2)20-6-3)9-11-7-8-12(16)10-13(11)17/h7-8,10,14-15,18H,4-6,9H2,1-3H3 |
| InChIKey | ILUXRFISIQDMGG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|