C16H26FNO2 — CID 114348126
1,1-diethoxy-N-ethyl-3-(4-fluoro-2-methylphenyl)propan-2-amine (PubChem CID 114348126) has the molecular formula C16H26FNO2 and a molecular weight of 283.39 g/mol. Its IUPAC name is 1,1-diethoxy-N-ethyl-3-(4-fluoro-2-methylphenyl)propan-2-amine.
| Compound Name | 1,1-diethoxy-N-ethyl-3-(4-fluoro-2-methylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 114348126 |
| Molecular Formula | C16H26FNO2 |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1,1-diethoxy-N-ethyl-3-(4-fluoro-2-methylphenyl)propan-2-amine |
| SMILES | CCNC(Cc1ccc(F)cc1C)C(OCC)OCC |
| InChI | InChI=1S/C16H26FNO2/c1-5-18-15(16(19-6-2)20-7-3)11-13-8-9-14(17)10-12(13)4/h8-10,15-16,18H,5-7,11H2,1-4H3 |
| InChIKey | YYUASURNWGQIMN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|