C17H29NO2 — CID 79495019
3-(2,5-dimethylphenyl)-1,1-diethoxy-N-ethylpropan-2-amine (PubChem CID 79495019) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-1,1-diethoxy-N-ethylpropan-2-amine.
| Compound Name | 3-(2,5-dimethylphenyl)-1,1-diethoxy-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 79495019 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-1,1-diethoxy-N-ethylpropan-2-amine |
| SMILES | CCNC(Cc1cc(C)ccc1C)C(OCC)OCC |
| InChI | InChI=1S/C17H29NO2/c1-6-18-16(17(19-7-2)20-8-3)12-15-11-13(4)9-10-14(15)5/h9-11,16-18H,6-8,12H2,1-5H3 |
| InChIKey | CCYKZCMYZFHUIH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|