C19H25N — CID 61482245
1-(2,5-dimethylphenyl)-N-ethyl-3-phenylpropan-2-amine (PubChem CID 61482245) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-ethyl-3-phenylpropan-2-amine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-ethyl-3-phenylpropan-2-amine |
|---|---|
| PubChem CID | 61482245 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-ethyl-3-phenylpropan-2-amine |
| SMILES | CCNC(Cc1ccccc1)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C19H25N/c1-4-20-19(13-17-8-6-5-7-9-17)14-18-12-15(2)10-11-16(18)3/h5-12,19-20H,4,13-14H2,1-3H3 |
| InChIKey | OURMIMPXPCVIDR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |