C18H25NS — CID 115856849
1-(2,5-dimethylphenyl)-N-ethyl-4-thiophen-3-ylbutan-2-amine (PubChem CID 115856849) has the molecular formula C18H25NS and a molecular weight of 287.47 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-ethyl-4-thiophen-3-ylbutan-2-amine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-ethyl-4-thiophen-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 115856849 |
| Molecular Formula | C18H25NS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-ethyl-4-thiophen-3-ylbutan-2-amine |
| SMILES | CCNC(CCc1ccsc1)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C18H25NS/c1-4-19-18(8-7-16-9-10-20-13-16)12-17-11-14(2)5-6-15(17)3/h5-6,9-11,13,18-19H,4,7-8,12H2,1-3H3 |
| InChIKey | FMQQRGGQGKSWNH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |