C15H25N — CID 61482090
1-(2,5-dimethylphenyl)-N-ethylpentan-2-amine (PubChem CID 61482090) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-ethylpentan-2-amine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-ethylpentan-2-amine |
|---|---|
| PubChem CID | 61482090 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-ethylpentan-2-amine |
| SMILES | CCCC(Cc1cc(C)ccc1C)NCC |
| InChI | InChI=1S/C15H25N/c1-5-7-15(16-6-2)11-14-10-12(3)8-9-13(14)4/h8-10,15-16H,5-7,11H2,1-4H3 |
| InChIKey | BDKONYGSNJRWTG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |